About (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone
(2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 22523687) has the molecular formula C24H20N6OS
and a molecular weight of 440.53 g/mol. Its IUPAC name is (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 22523687 |
| Molecular Formula | C24H20N6OS |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)sc1nc(-c3ccccc3)cn12)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H20N6OS/c31-22(28-11-13-29(14-12-28)23-25-9-4-10-26-23)18-7-8-20-21(15-18)32-24-27-19(16-30(20)24)17-5-2-1-3-6-17/h1-10,15-16H,11-14H2 |
| InChIKey | IBWRGZFCMMDZDX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone?
The IUPAC name of (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (CID 22523687) is (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone is O=C(c1ccc2c(c1)sc1nc(-c3ccccc3)cn12)N1CCN(c2ncccn2)CC1.
What is the InChIKey of (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone?
The InChIKey is IBWRGZFCMMDZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N6OS/c31-22(28-11-13-29(14-12-28)23-25-9-4-10-26-23)18-7-8-20-21(15-18)32-24-27-19(16-30(20)24)17-5-2-1-3-6-17/h1-10,15-16H,11-14H2.
What are the key properties of (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone?
(2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone has a molecular weight of 440.53 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylimidazo[2,1-b][1,3]benzothiazol-6-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 22523687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).