C16H13N2PS — CID 145482411
[2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]phosphane (PubChem CID 145482411) has the molecular formula C16H13N2PS and a molecular weight of 296.34 g/mol. Its IUPAC name is [2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]phosphane.
| Compound Name | [2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]phosphane |
|---|---|
| PubChem CID | 145482411 |
| Molecular Formula | C16H13N2PS |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | [2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]phosphane |
| SMILES | Cc1ccc(-c2cn3c(n2)sc2cc(P)ccc23)cc1 |
| InChI | InChI=1S/C16H13N2PS/c1-10-2-4-11(5-3-10)13-9-18-14-7-6-12(19)8-15(14)20-16(18)17-13/h2-9H,19H2,1H3 |
| InChIKey | QJDCELCIAOSQRS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|