C16H11ClN2O2S2 — CID 1211584
2-(4-chlorophenyl)-6-methylsulfonylimidazo[2,1-b][1,3]benzothiazole (PubChem CID 1211584) has the molecular formula C16H11ClN2O2S2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methylsulfonylimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(4-chlorophenyl)-6-methylsulfonylimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 1211584 |
| Molecular Formula | C16H11ClN2O2S2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methylsulfonylimidazo[2,1-b][1,3]benzothiazole |
| SMILES | CS(=O)(=O)c1ccc2c(c1)sc1nc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C16H11ClN2O2S2/c1-23(20,21)12-6-7-14-15(8-12)22-16-18-13(9-19(14)16)10-2-4-11(17)5-3-10/h2-9H,1H3 |
| InChIKey | HSOVSLGHXBWSIK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |