C25H21N — CID 132529641
4-(3,5-dimethylphenyl)-2,6-diphenylpyridine (PubChem CID 132529641) has the molecular formula C25H21N and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2,6-diphenylpyridine.
| Compound Name | 4-(3,5-dimethylphenyl)-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 132529641 |
| Molecular Formula | C25H21N |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2,6-diphenylpyridine |
| SMILES | Cc1cc(C)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H21N/c1-18-13-19(2)15-22(14-18)23-16-24(20-9-5-3-6-10-20)26-25(17-23)21-11-7-4-8-12-21/h3-17H,1-2H3 |
| InChIKey | YHFPUBBQAOGDJZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |