C24H16Cl2N2S — CID 13353786
2,3-bis(4-chlorophenyl)-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 13353786) has the molecular formula C24H16Cl2N2S and a molecular weight of 435.38 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 2,3-bis(4-chlorophenyl)-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 13353786 |
| Molecular Formula | C24H16Cl2N2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccc(-c2cn3c(-c4ccc(Cl)cc4)c(-c4ccc(Cl)cc4)sc3n2)cc1 |
| InChI | InChI=1S/C24H16Cl2N2S/c1-15-2-4-16(5-3-15)21-14-28-22(17-6-10-19(25)11-7-17)23(29-24(28)27-21)18-8-12-20(26)13-9-18/h2-14H,1H3 |
| InChIKey | SCKPYQVQVLSWHC-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |