C17H13N3S — CID 142129506
3-(4-methylphenyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]thiazole (PubChem CID 142129506) has the molecular formula C17H13N3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-(4-methylphenyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 142129506 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-(4-methylphenyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccc(-c2c(-c3ccncc3)sc3nccn23)cc1 |
| InChI | InChI=1S/C17H13N3S/c1-12-2-4-13(5-3-12)15-16(14-6-8-18-9-7-14)21-17-19-10-11-20(15)17/h2-11H,1H3 |
| InChIKey | IYPMRWHFDZNPOF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |