C18H15N3S — CID 71552988
5,6-bis(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole (PubChem CID 71552988) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is 5,6-bis(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole.
| Compound Name | 5,6-bis(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 71552988 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 5,6-bis(4-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole |
| SMILES | Cc1ccc(-c2sc3ncnn3c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H15N3S/c1-12-3-7-14(8-4-12)16-17(15-9-5-13(2)6-10-15)22-18-19-11-20-21(16)18/h3-11H,1-2H3 |
| InChIKey | ATASHIQXOIMKAK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |