C21H21N4OS+ — CID 2148989
5-[(R)-(4-methylphenyl)-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 2148989) has the molecular formula C21H21N4OS+ and a molecular weight of 377.49 g/mol. Its IUPAC name is 5-[(R)-(4-methylphenyl)-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(R)-(4-methylphenyl)-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 2148989 |
| Molecular Formula | C21H21N4OS+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[(R)-(4-methylphenyl)-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | Cc1ccc([C@H](c2sc3ncnn3c2O)[NH+]2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H20N4OS/c1-14-6-8-16(9-7-14)18(19-20(26)25-21(27-19)22-13-23-25)24-11-10-15-4-2-3-5-17(15)12-24/h2-9,13,18,26H,10-12H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | CPEDWIUWUSNASB-GOSISDBHSA-O |
| XLogP | 2.54 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |