C19H19N4O2S+ — CID 7105393
5-[(R)-furan-2-yl(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7105393) has the molecular formula C19H19N4O2S+ and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[(R)-furan-2-yl(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(R)-furan-2-yl(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7105393 |
| Molecular Formula | C19H19N4O2S+ |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-[(R)-furan-2-yl(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | Cc1nc2sc([C@@H](c3ccco3)[NH+]3CCc4ccccc4C3)c(O)n2n1 |
| InChI | InChI=1S/C19H18N4O2S/c1-12-20-19-23(21-12)18(24)17(26-19)16(15-7-4-10-25-15)22-9-8-13-5-2-3-6-14(13)11-22/h2-7,10,16,24H,8-9,11H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | LGBUTYWRDCVEMH-MRXNPFEDSA-O |
| XLogP | 2.13 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |