C42H31O4S4+ — CID 164708052
[2,5-dimethyl-4-(9-oxothioxanthen-2-yl)sulfonylphenyl]-(2,5-dimethylphenyl)-(9-oxothioxanthen-2-yl)sulfanium (PubChem CID 164708052) has the molecular formula C42H31O4S4+ and a molecular weight of 727.97 g/mol. Its IUPAC name is [2,5-dimethyl-4-(9-oxothioxanthen-2-yl)sulfonylphenyl]-(2,5-dimethylphenyl)-(9-oxothioxanthen-2-yl)sulfanium.
| Compound Name | [2,5-dimethyl-4-(9-oxothioxanthen-2-yl)sulfonylphenyl]-(2,5-dimethylphenyl)-(9-oxothioxanthen-2-yl)sulfanium |
|---|---|
| PubChem CID | 164708052 |
| Molecular Formula | C42H31O4S4+ |
| Molecular Weight | 727.97 g/mol |
| Exact Mass | 727.11 |
| IUPAC Name | [2,5-dimethyl-4-(9-oxothioxanthen-2-yl)sulfonylphenyl]-(2,5-dimethylphenyl)-(9-oxothioxanthen-2-yl)sulfanium |
| SMILES | Cc1ccc(C)c([S+](c2ccc3sc4ccccc4c(=O)c3c2)c2cc(C)c(S(=O)(=O)c3ccc4sc5ccccc5c(=O)c4c3)cc2C)c1 |
| InChI | InChI=1S/C42H31O4S4/c1-24-13-14-25(2)38(19-24)49(28-15-17-36-32(22-28)41(43)30-9-5-7-11-34(30)47-36)39-20-27(4)40(21-26(39)3)50(45,46)29-16-18-37-33(23-29)42(44)31-10-6-8-12-35(31)48-37/h5-23H,1-4H3/q+1 |
| InChIKey | OBEZRQGZIRGVII-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.97 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|