C40H27O4S4+ — CID 163555269
[2-methoxy-4-(9-oxothioxanthen-2-yl)sulfanylphenyl]-(3-methoxyphenyl)-(9-oxothioxanthen-2-yl)sulfanium (PubChem CID 163555269) has the molecular formula C40H27O4S4+ and a molecular weight of 699.92 g/mol. Its IUPAC name is [2-methoxy-4-(9-oxothioxanthen-2-yl)sulfanylphenyl]-(3-methoxyphenyl)-(9-oxothioxanthen-2-yl)sulfanium.
| Compound Name | [2-methoxy-4-(9-oxothioxanthen-2-yl)sulfanylphenyl]-(3-methoxyphenyl)-(9-oxothioxanthen-2-yl)sulfanium |
|---|---|
| PubChem CID | 163555269 |
| Molecular Formula | C40H27O4S4+ |
| Molecular Weight | 699.92 g/mol |
| Exact Mass | 699.08 |
| IUPAC Name | [2-methoxy-4-(9-oxothioxanthen-2-yl)sulfanylphenyl]-(3-methoxyphenyl)-(9-oxothioxanthen-2-yl)sulfanium |
| SMILES | COc1cccc([S+](c2ccc3sc4ccccc4c(=O)c3c2)c2ccc(Sc3ccc4sc5ccccc5c(=O)c4c3)cc2OC)c1 |
| InChI | InChI=1S/C40H27O4S4/c1-43-24-8-7-9-27(20-24)48(28-16-18-37-32(23-28)40(42)30-11-4-6-13-35(30)47-37)38-19-15-26(22-33(38)44-2)45-25-14-17-36-31(21-25)39(41)29-10-3-5-12-34(29)46-36/h3-23H,1-2H3/q+1 |
| InChIKey | FMMMNLHPDYFZPN-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.92 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|