C38H31O2S2+ — CID 147710735
(3-methoxyphenyl)-[2-methoxy-4-(4-phenylphenyl)sulfanylphenyl]-(4-phenylphenyl)sulfanium (PubChem CID 147710735) has the molecular formula C38H31O2S2+ and a molecular weight of 583.80 g/mol. Its IUPAC name is (3-methoxyphenyl)-[2-methoxy-4-(4-phenylphenyl)sulfanylphenyl]-(4-phenylphenyl)sulfanium.
| Compound Name | (3-methoxyphenyl)-[2-methoxy-4-(4-phenylphenyl)sulfanylphenyl]-(4-phenylphenyl)sulfanium |
|---|---|
| PubChem CID | 147710735 |
| Molecular Formula | C38H31O2S2+ |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | (3-methoxyphenyl)-[2-methoxy-4-(4-phenylphenyl)sulfanylphenyl]-(4-phenylphenyl)sulfanium |
| SMILES | COc1cccc([S+](c2ccc(-c3ccccc3)cc2)c2ccc(Sc3ccc(-c4ccccc4)cc3)cc2OC)c1 |
| InChI | InChI=1S/C38H31O2S2/c1-39-32-14-9-15-36(26-32)42(35-23-18-31(19-24-35)29-12-7-4-8-13-29)38-25-22-34(27-37(38)40-2)41-33-20-16-30(17-21-33)28-10-5-3-6-11-28/h3-27H,1-2H3/q+1 |
| InChIKey | GUQQDNOXNJMLOE-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|