C40H36O3S3+2 — CID 159907768
bis(4-methoxyphenyl)-[4-[4-[(4-methoxyphenyl)-(4-methylphenyl)sulfonio]phenyl]sulfanylphenyl]sulfanium (PubChem CID 159907768) has the molecular formula C40H36O3S3+2 and a molecular weight of 660.93 g/mol. Its IUPAC name is bis(4-methoxyphenyl)-[4-[4-[(4-methoxyphenyl)-(4-methylphenyl)sulfonio]phenyl]sulfanylphenyl]sulfanium.
| Compound Name | bis(4-methoxyphenyl)-[4-[4-[(4-methoxyphenyl)-(4-methylphenyl)sulfonio]phenyl]sulfanylphenyl]sulfanium |
|---|---|
| PubChem CID | 159907768 |
| Molecular Formula | C40H36O3S3+2 |
| Molecular Weight | 660.93 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | bis(4-methoxyphenyl)-[4-[4-[(4-methoxyphenyl)-(4-methylphenyl)sulfonio]phenyl]sulfanylphenyl]sulfanium |
| SMILES | COc1ccc([S+](c2ccc(C)cc2)c2ccc(Sc3ccc([S+](c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H36O3S3/c1-29-5-17-35(18-6-29)45(36-19-7-30(41-2)8-20-36)39-25-13-33(14-26-39)44-34-15-27-40(28-16-34)46(37-21-9-31(42-3)10-22-37)38-23-11-32(43-4)12-24-38/h5-28H,1-4H3/q+2 |
| InChIKey | LYUXXLPEKNNKKD-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.93 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|