C25H23O2S3+ — CID 87435588
bis(4-methoxyphenyl)-[5-(4-methylphenyl)sulfanylthiophen-2-yl]sulfanium (PubChem CID 87435588) has the molecular formula C25H23O2S3+ and a molecular weight of 451.66 g/mol. Its IUPAC name is bis(4-methoxyphenyl)-[5-(4-methylphenyl)sulfanylthiophen-2-yl]sulfanium.
| Compound Name | bis(4-methoxyphenyl)-[5-(4-methylphenyl)sulfanylthiophen-2-yl]sulfanium |
|---|---|
| PubChem CID | 87435588 |
| Molecular Formula | C25H23O2S3+ |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | bis(4-methoxyphenyl)-[5-(4-methylphenyl)sulfanylthiophen-2-yl]sulfanium |
| SMILES | COc1ccc([S+](c2ccc(OC)cc2)c2ccc(Sc3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C25H23O2S3/c1-18-4-10-21(11-5-18)28-24-16-17-25(29-24)30(22-12-6-19(26-2)7-13-22)23-14-8-20(27-3)9-15-23/h4-17H,1-3H3/q+1 |
| InChIKey | RJLFEGHRSDOZTD-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|