C15H16OS — CID 165348232
1,4-dimethyl-2-(4-methylphenyl)sulfinylbenzene (PubChem CID 165348232) has the molecular formula C15H16OS and a molecular weight of 244.36 g/mol. Its IUPAC name is 1,4-dimethyl-2-(4-methylphenyl)sulfinylbenzene.
| Compound Name | 1,4-dimethyl-2-(4-methylphenyl)sulfinylbenzene |
|---|---|
| PubChem CID | 165348232 |
| Molecular Formula | C15H16OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1,4-dimethyl-2-(4-methylphenyl)sulfinylbenzene |
| SMILES | Cc1ccc(S(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C15H16OS/c1-11-5-8-14(9-6-11)17(16)15-10-12(2)4-7-13(15)3/h4-10H,1-3H3 |
| InChIKey | MBPWJTKSFPFSFH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |