C12H19NOS — CID 64657321
3-(2,5-dimethylphenyl)sulfinylbutan-2-amine (PubChem CID 64657321) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)sulfinylbutan-2-amine.
| Compound Name | 3-(2,5-dimethylphenyl)sulfinylbutan-2-amine |
|---|---|
| PubChem CID | 64657321 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)sulfinylbutan-2-amine |
| SMILES | Cc1ccc(C)c(S(=O)C(C)C(C)N)c1 |
| InChI | InChI=1S/C12H19NOS/c1-8-5-6-9(2)12(7-8)15(14)11(4)10(3)13/h5-7,10-11H,13H2,1-4H3 |
| InChIKey | QPIFIWMMEUFXJX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |