C10H15N — CID 4991344
1-(2,5-dimethylphenyl)ethanamine (PubChem CID 4991344) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)ethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 4991344 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(C)c(C(C)N)c1 |
| InChI | InChI=1S/C10H15N/c1-7-4-5-8(2)10(6-7)9(3)11/h4-6,9H,11H2,1-3H3 |
| InChIKey | ULGHUDXDTMIEAM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |