C12H20N2 — CID 116933200
1-(2,5-dimethylphenyl)butane-1,3-diamine (PubChem CID 116933200) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)butane-1,3-diamine.
| Compound Name | 1-(2,5-dimethylphenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 116933200 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)butane-1,3-diamine |
| SMILES | Cc1ccc(C)c(C(N)CC(C)N)c1 |
| InChI | InChI=1S/C12H20N2/c1-8-4-5-9(2)11(6-8)12(14)7-10(3)13/h4-6,10,12H,7,13-14H2,1-3H3 |
| InChIKey | FFKIZNLYRMXINE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |