C10H14ClN — CID 116937497
2-chloro-1-(2,5-dimethylphenyl)ethanamine (PubChem CID 116937497) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is 2-chloro-1-(2,5-dimethylphenyl)ethanamine.
| Compound Name | 2-chloro-1-(2,5-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 116937497 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-chloro-1-(2,5-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(C)c(C(N)CCl)c1 |
| InChI | InChI=1S/C10H14ClN/c1-7-3-4-8(2)9(5-7)10(12)6-11/h3-5,10H,6,12H2,1-2H3 |
| InChIKey | RJIUXVRQYUXKQG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|