C16H17Cl — CID 66436960
2-(2-chloro-1-phenylethyl)-1,4-dimethylbenzene (PubChem CID 66436960) has the molecular formula C16H17Cl and a molecular weight of 244.77 g/mol. Its IUPAC name is 2-(2-chloro-1-phenylethyl)-1,4-dimethylbenzene.
| Compound Name | 2-(2-chloro-1-phenylethyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 66436960 |
| Molecular Formula | C16H17Cl |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(2-chloro-1-phenylethyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C(CCl)c2ccccc2)c1 |
| InChI | InChI=1S/C16H17Cl/c1-12-8-9-13(2)15(10-12)16(11-17)14-6-4-3-5-7-14/h3-10,16H,11H2,1-2H3 |
| InChIKey | VEYCLHCKCVSODJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|