2-(2,5-dimethylphenyl)-3-phenylbutanoic acid

C18H20O2 — CID 82140170

IUPAC2-(2,5-dimethylphenyl)-3-phenylbutanoic acid
SMILESCc1ccc(C)c(C(C(=O)O)C(C)c2ccccc2)c1
InChIInChI=1S/C18H20O2/c1-12-9-10-13(2)16(11-12)17(18(19)20)14(3)15-7-5-4-6-8-15/h4-11,14,17H,1-3H3,(H,19,20)
InChIKeyCPQHAABQIRMQOP-UHFFFAOYSA-N
MW268.36 g/mol
LogP4.28
Rot. Bonds4

About 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid

2-(2,5-dimethylphenyl)-3-phenylbutanoic acid (PubChem CID 82140170) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid.

Molecular Properties

Compound Name2-(2,5-dimethylphenyl)-3-phenylbutanoic acid
PubChem CID82140170
Molecular FormulaC18H20O2
Molecular Weight268.36 g/mol
Exact Mass268.15
IUPAC Name2-(2,5-dimethylphenyl)-3-phenylbutanoic acid
SMILESCc1ccc(C)c(C(C(=O)O)C(C)c2ccccc2)c1
InChIInChI=1S/C18H20O2/c1-12-9-10-13(2)16(11-12)17(18(19)20)14(3)15-7-5-4-6-8-15/h4-11,14,17H,1-3H3,(H,19,20)
InChIKeyCPQHAABQIRMQOP-UHFFFAOYSA-N
XLogP4.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.36
LogP ≤ 54.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid?
The IUPAC name of 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid (CID 82140170) is 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid.
What is the SMILES notation for 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid?
The canonical SMILES for 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid is Cc1ccc(C)c(C(C(=O)O)C(C)c2ccccc2)c1.
What is the InChIKey of 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid?
The InChIKey is CPQHAABQIRMQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-12-9-10-13(2)16(11-12)17(18(19)20)14(3)15-7-5-4-6-8-15/h4-11,14,17H,1-3H3,(H,19,20).
What are the key properties of 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid?
2-(2,5-dimethylphenyl)-3-phenylbutanoic acid has a molecular weight of 268.36 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylphenyl)-3-phenylbutanoic acid is sourced from PubChem (CID 82140170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).