About [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate
[(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate (PubChem CID 142400328) has the molecular formula C23H30O2
and a molecular weight of 338.49 g/mol. Its IUPAC name is [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate.
Molecular Properties
| Compound Name | [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate |
| PubChem CID | 142400328 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate |
| SMILES | Cc1ccc(C)c([C@@H](C(C)C)[C@H](C)OC(=O)[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H30O2/c1-15(2)22(21-14-16(3)12-13-17(21)4)19(6)25-23(24)18(5)20-10-8-7-9-11-20/h7-15,18-19,22H,1-6H3/t18-,19-,22-/m0/s1 |
| InChIKey | XHTQEFNUYKSMDH-IPJJNNNSSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate?
The IUPAC name of [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate (CID 142400328) is [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate.
What is the SMILES notation for [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate?
The canonical SMILES for [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate is Cc1ccc(C)c([C@@H](C(C)C)[C@H](C)OC(=O)[C@@H](C)c2ccccc2)c1.
What is the InChIKey of [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate?
The InChIKey is XHTQEFNUYKSMDH-IPJJNNNSSA-N. The full InChI is InChI=1S/C23H30O2/c1-15(2)22(21-14-16(3)12-13-17(21)4)19(6)25-23(24)18(5)20-10-8-7-9-11-20/h7-15,18-19,22H,1-6H3/t18-,19-,22-/m0/s1.
What are the key properties of [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate?
[(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate has a molecular weight of 338.49 g/mol, XLogP of 5.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-3-(2,5-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-phenylpropanoate is sourced from PubChem (CID 142400328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).