About 1-phenylpropyl 2-phenylpropanoate
1-phenylpropyl 2-phenylpropanoate (PubChem CID 174489936) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-phenylpropyl 2-phenylpropanoate.
Molecular Properties
| Compound Name | 1-phenylpropyl 2-phenylpropanoate |
| PubChem CID | 174489936 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-phenylpropyl 2-phenylpropanoate |
| SMILES | CCC(OC(=O)C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-3-17(16-12-8-5-9-13-16)20-18(19)14(2)15-10-6-4-7-11-15/h4-14,17H,3H2,1-2H3 |
| InChIKey | DHIROIXNCNLKRM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropyl 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropyl 2-phenylpropanoate?
The IUPAC name of 1-phenylpropyl 2-phenylpropanoate (CID 174489936) is 1-phenylpropyl 2-phenylpropanoate.
What is the SMILES notation for 1-phenylpropyl 2-phenylpropanoate?
The canonical SMILES for 1-phenylpropyl 2-phenylpropanoate is CCC(OC(=O)C(C)c1ccccc1)c1ccccc1.
What is the InChIKey of 1-phenylpropyl 2-phenylpropanoate?
The InChIKey is DHIROIXNCNLKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-3-17(16-12-8-5-9-13-16)20-18(19)14(2)15-10-6-4-7-11-15/h4-14,17H,3H2,1-2H3.
What are the key properties of 1-phenylpropyl 2-phenylpropanoate?
1-phenylpropyl 2-phenylpropanoate has a molecular weight of 268.36 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropyl 2-phenylpropanoate is sourced from PubChem (CID 174489936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).