About pentyl (2S)-2-phenylpropanoate
pentyl (2S)-2-phenylpropanoate (PubChem CID 70845237) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is pentyl (2S)-2-phenylpropanoate.
Molecular Properties
| Compound Name | pentyl (2S)-2-phenylpropanoate |
| PubChem CID | 70845237 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | pentyl (2S)-2-phenylpropanoate |
| SMILES | CCCCCOC(=O)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-3-4-8-11-16-14(15)12(2)13-9-6-5-7-10-13/h5-7,9-10,12H,3-4,8,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | HDVFGKKFXKECPD-LBPRGKRZSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl (2S)-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl (2S)-2-phenylpropanoate?
The IUPAC name of pentyl (2S)-2-phenylpropanoate (CID 70845237) is pentyl (2S)-2-phenylpropanoate.
What is the SMILES notation for pentyl (2S)-2-phenylpropanoate?
The canonical SMILES for pentyl (2S)-2-phenylpropanoate is CCCCCOC(=O)[C@@H](C)c1ccccc1.
What is the InChIKey of pentyl (2S)-2-phenylpropanoate?
The InChIKey is HDVFGKKFXKECPD-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-4-8-11-16-14(15)12(2)13-9-6-5-7-10-13/h5-7,9-10,12H,3-4,8,11H2,1-2H3/t12-/m0/s1.
What are the key properties of pentyl (2S)-2-phenylpropanoate?
pentyl (2S)-2-phenylpropanoate has a molecular weight of 220.31 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl (2S)-2-phenylpropanoate is sourced from PubChem (CID 70845237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).