C21H34O2 — CID 15274994
octyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 15274994) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is octyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | octyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 15274994 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | octyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)[C@@H](C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C21H34O2/c1-5-6-7-8-9-10-15-23-21(22)18(4)20-13-11-19(12-14-20)16-17(2)3/h11-14,17-18H,5-10,15-16H2,1-4H3/t18-/m0/s1 |
| InChIKey | MKLFYFVVXDTVGT-SFHVURJKSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|