C15H22O2S — CID 10445655
2-sulfanylethyl 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 10445655) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-sulfanylethyl 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | 2-sulfanylethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 10445655 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-sulfanylethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)OCCS)cc1 |
| InChI | InChI=1S/C15H22O2S/c1-11(2)10-13-4-6-14(7-5-13)12(3)15(16)17-8-9-18/h4-7,11-12,18H,8-10H2,1-3H3 |
| InChIKey | DKHUAHFXUPCRDN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|