C17H24O2 — CID 175830731
but-3-enyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 175830731) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is but-3-enyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | but-3-enyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 175830731 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | but-3-enyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | C=CCCOC(=O)[C@H](C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C17H24O2/c1-5-6-11-19-17(18)14(4)16-9-7-15(8-10-16)12-13(2)3/h5,7-10,13-14H,1,6,11-12H2,2-4H3/t14-/m1/s1 |
| InChIKey | OZTVIHLPBJDAFA-CQSZACIVSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|