C21H32ClNO2 — CID 90388689
1-[bis(prop-2-enyl)amino]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate;hydrochloride (PubChem CID 90388689) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is 1-[bis(prop-2-enyl)amino]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate;hydrochloride.
| Compound Name | 1-[bis(prop-2-enyl)amino]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 90388689 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-[bis(prop-2-enyl)amino]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate;hydrochloride |
| SMILES | C=CCN(CC=C)C(C)OC(=O)C(C)c1ccc(CC(C)C)cc1.Cl |
| InChI | InChI=1S/C21H31NO2.ClH/c1-7-13-22(14-8-2)18(6)24-21(23)17(5)20-11-9-19(10-12-20)15-16(3)4;/h7-12,16-18H,1-2,13-15H2,3-6H3;1H |
| InChIKey | YARWJRLDRJNSCS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|