C27H36O4 — CID 118682684
[(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]oxymethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 118682684) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is [(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]oxymethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]oxymethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 118682684 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl]oxymethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc([C@H](C)C(=O)OCOC(=O)[C@@H](C)c2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H36O4/c1-18(2)15-22-7-11-24(12-8-22)20(5)26(28)30-17-31-27(29)21(6)25-13-9-23(10-14-25)16-19(3)4/h7-14,18-21H,15-17H2,1-6H3/t20-,21-/m0/s1 |
| InChIKey | ALPPJQMRYAVMEY-SFTDATJTSA-N |
| XLogP | 6.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|