C13H18NaO2 — CID 45052535
Ibuprofen (sodium) (PubChem CID 45052535) has the molecular formula C13H18NaO2 and a molecular weight of 229.28 g/mol.
| Compound Name | Ibuprofen (sodium) |
|---|---|
| PubChem CID | 45052535 |
| Molecular Formula | C13H18NaO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)O)cc1.[Na] |
| InChI | InChI=1S/C13H18O2.Na/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;/h4-7,9-10H,8H2,1-3H3,(H,14,15); |
| InChIKey | VYBJYTLOZWAVMJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |