C17H30ClNO3 — CID 70389408
1-(dimethylamino)ethanol;2-[4-(2-methylpropyl)phenyl]propanoic acid;hydrochloride (PubChem CID 70389408) has the molecular formula C17H30ClNO3 and a molecular weight of 331.88 g/mol. Its IUPAC name is 1-(dimethylamino)ethanol;2-[4-(2-methylpropyl)phenyl]propanoic acid;hydrochloride.
| Compound Name | 1-(dimethylamino)ethanol;2-[4-(2-methylpropyl)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70389408 |
| Molecular Formula | C17H30ClNO3 |
| Molecular Weight | 331.88 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(dimethylamino)ethanol;2-[4-(2-methylpropyl)phenyl]propanoic acid;hydrochloride |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)O)cc1.CC(O)N(C)C.Cl |
| InChI | InChI=1S/C13H18O2.C4H11NO.ClH/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;1-4(6)5(2)3;/h4-7,9-10H,8H2,1-3H3,(H,14,15);4,6H,1-3H3;1H |
| InChIKey | FUHGWYJJGXSHBF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|