C13H18O2Sn — CID 175760114
CID 175760114 (PubChem CID 175760114) has the molecular formula C13H18O2Sn and a molecular weight of 325.00 g/mol.
| Compound Name | CID 175760114 |
|---|---|
| PubChem CID | 175760114 |
| Molecular Formula | C13H18O2Sn |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)O)cc1.[Sn] |
| InChI | InChI=1S/C13H18O2.Sn/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;/h4-7,9-10H,8H2,1-3H3,(H,14,15); |
| InChIKey | FLZFJDQPBKGENW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |