About 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate
3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 11727156) has the molecular formula C16H23BrO2
and a molecular weight of 327.26 g/mol. Its IUPAC name is 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate.
Molecular Properties
| Compound Name | 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| PubChem CID | 11727156 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)OCCCBr)cc1 |
| InChI | InChI=1S/C16H23BrO2/c1-12(2)11-14-5-7-15(8-6-14)13(3)16(18)19-10-4-9-17/h5-8,12-13H,4,9-11H2,1-3H3 |
| InChIKey | ZIZOLNHVJWJESE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate?
The IUPAC name of 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate (CID 11727156) is 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate.
What is the SMILES notation for 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate?
The canonical SMILES for 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate is CC(C)Cc1ccc(C(C)C(=O)OCCCBr)cc1.
What is the InChIKey of 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate?
The InChIKey is ZIZOLNHVJWJESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrO2/c1-12(2)11-14-5-7-15(8-6-14)13(3)16(18)19-10-4-9-17/h5-8,12-13H,4,9-11H2,1-3H3.
What are the key properties of 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate?
3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate has a molecular weight of 327.26 g/mol, XLogP of 4.32, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopropyl 2-[4-(2-methylpropyl)phenyl]propanoate is sourced from PubChem (CID 11727156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).