C29H40O2Si2 — CID 175830733
4-diphenylsilylbutyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate;silane (PubChem CID 175830733) has the molecular formula C29H40O2Si2 and a molecular weight of 476.81 g/mol. Its IUPAC name is 4-diphenylsilylbutyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate;silane.
| Compound Name | 4-diphenylsilylbutyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate;silane |
|---|---|
| PubChem CID | 175830733 |
| Molecular Formula | C29H40O2Si2 |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 4-diphenylsilylbutyl (2R)-2-[4-(2-methylpropyl)phenyl]propanoate;silane |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(=O)OCCCC[SiH](c2ccccc2)c2ccccc2)cc1.[SiH4] |
| InChI | InChI=1S/C29H36O2Si.H4Si/c1-23(2)22-25-16-18-26(19-17-25)24(3)29(30)31-20-10-11-21-32(27-12-6-4-7-13-27)28-14-8-5-9-15-28;/h4-9,12-19,23-24,32H,10-11,20-22H2,1-3H3;1H4/t24-;/m1./s1 |
| InChIKey | SCTAAOXFLUHOMD-GJFSDDNBSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|