About (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium
(5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium (PubChem CID 143892618) has the molecular formula C20H30O3V
and a molecular weight of 369.40 g/mol. Its IUPAC name is (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium.
Molecular Properties
| Compound Name | (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium |
| PubChem CID | 143892618 |
| Molecular Formula | C20H30O3V |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)OCCCC(=O)C(C)C)cc1.[V] |
| InChI | InChI=1S/C20H30O3.V/c1-14(2)13-17-8-10-18(11-9-17)16(5)20(22)23-12-6-7-19(21)15(3)4;/h8-11,14-16H,6-7,12-13H2,1-5H3; |
| InChIKey | GUAXAYQHZLSPAG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium?
The IUPAC name of (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium (CID 143892618) is (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium.
What is the SMILES notation for (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium?
The canonical SMILES for (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium is CC(C)Cc1ccc(C(C)C(=O)OCCCC(=O)C(C)C)cc1.[V].
What is the InChIKey of (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium?
The InChIKey is GUAXAYQHZLSPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O3.V/c1-14(2)13-17-8-10-18(11-9-17)16(5)20(22)23-12-6-7-19(21)15(3)4;/h8-11,14-16H,6-7,12-13H2,1-5H3;.
What are the key properties of (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium?
(5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium has a molecular weight of 369.40 g/mol, XLogP of 4.53, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-4-oxohexyl) 2-[4-(2-methylpropyl)phenyl]propanoate;vanadium is sourced from PubChem (CID 143892618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).