C18H26O5 — CID 166563136
(1-carboxyoxy-2-methylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 166563136) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (1-carboxyoxy-2-methylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | (1-carboxyoxy-2-methylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 166563136 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (1-carboxyoxy-2-methylpropyl) 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)OC(OC(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C18H26O5/c1-11(2)10-14-6-8-15(9-7-14)13(5)16(19)22-17(12(3)4)23-18(20)21/h6-9,11-13,17H,10H2,1-5H3,(H,20,21) |
| InChIKey | GAVXFBDSUBMKJJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|