About phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate
phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 141462539) has the molecular formula C19H22O2Se
and a molecular weight of 361.34 g/mol. Its IUPAC name is phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate.
Molecular Properties
| Compound Name | phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| PubChem CID | 141462539 |
| Molecular Formula | C19H22O2Se |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)O[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O2Se/c1-14(2)13-16-9-11-17(12-10-16)15(3)19(20)21-22-18-7-5-4-6-8-18/h4-12,14-15H,13H2,1-3H3 |
| InChIKey | CCSIGQPYBONETO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate?
The IUPAC name of phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate (CID 141462539) is phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate.
What is the SMILES notation for phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate?
The canonical SMILES for phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate is CC(C)Cc1ccc(C(C)C(=O)O[Se]c2ccccc2)cc1.
What is the InChIKey of phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate?
The InChIKey is CCSIGQPYBONETO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2Se/c1-14(2)13-16-9-11-17(12-10-16)15(3)19(20)21-22-18-7-5-4-6-8-18/h4-12,14-15H,13H2,1-3H3.
What are the key properties of phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate?
phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate has a molecular weight of 361.34 g/mol, XLogP of 3.48, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylselanyl 2-[4-(2-methylpropyl)phenyl]propanoate is sourced from PubChem (CID 141462539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).