C17H24O5 — CID 166563144
1-carboxyoxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 166563144) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-carboxyoxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | 1-carboxyoxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 166563144 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-carboxyoxypropyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CCC(OC(=O)O)OC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C17H24O5/c1-5-15(22-17(19)20)21-16(18)12(4)14-8-6-13(7-9-14)10-11(2)3/h6-9,11-12,15H,5,10H2,1-4H3,(H,19,20) |
| InChIKey | QMVIBXJCKALBJS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|