C50H91NO5 — CID 177352859
heptadecan-9-yl 6-[4-hydroxybutyl-[10-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]decyl]amino]hexanoate (PubChem CID 177352859) has the molecular formula C50H91NO5 and a molecular weight of 786.28 g/mol. Its IUPAC name is heptadecan-9-yl 6-[4-hydroxybutyl-[10-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]decyl]amino]hexanoate.
| Compound Name | heptadecan-9-yl 6-[4-hydroxybutyl-[10-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]decyl]amino]hexanoate |
|---|---|
| PubChem CID | 177352859 |
| Molecular Formula | C50H91NO5 |
| Molecular Weight | 786.28 g/mol |
| Exact Mass | 785.69 |
| IUPAC Name | heptadecan-9-yl 6-[4-hydroxybutyl-[10-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]decyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCN(CCCCO)CCCCCCCCCCOC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C50H91NO5/c1-6-8-10-12-18-23-31-48(32-24-19-13-11-9-7-2)56-49(53)33-25-22-27-39-51(40-28-29-41-52)38-26-20-16-14-15-17-21-30-42-55-50(54)45(5)47-36-34-46(35-37-47)43-44(3)4/h34-37,44-45,48,52H,6-33,38-43H2,1-5H3 |
| InChIKey | XXWYDQZOKPDDRS-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.28 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|