C50H91NO7 — CID 177352921
1,3-didecoxypropan-2-yl 4-[4-hydroxybutyl-[6-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]hexyl]amino]butanoate (PubChem CID 177352921) has the molecular formula C50H91NO7 and a molecular weight of 818.28 g/mol. Its IUPAC name is 1,3-didecoxypropan-2-yl 4-[4-hydroxybutyl-[6-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]hexyl]amino]butanoate.
| Compound Name | 1,3-didecoxypropan-2-yl 4-[4-hydroxybutyl-[6-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]hexyl]amino]butanoate |
|---|---|
| PubChem CID | 177352921 |
| Molecular Formula | C50H91NO7 |
| Molecular Weight | 818.28 g/mol |
| Exact Mass | 817.68 |
| IUPAC Name | 1,3-didecoxypropan-2-yl 4-[4-hydroxybutyl-[6-[2-[4-(2-methylpropyl)phenyl]propanoyloxy]hexyl]amino]butanoate |
| SMILES | CCCCCCCCCCOCC(COCCCCCCCCCC)OC(=O)CCCN(CCCCO)CCCCCCOC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C50H91NO7/c1-6-8-10-12-14-16-19-25-38-55-42-48(43-56-39-26-20-17-15-13-11-9-7-2)58-49(53)29-28-36-51(35-23-24-37-52)34-22-18-21-27-40-57-50(54)45(5)47-32-30-46(31-33-47)41-44(3)4/h30-33,44-45,48,52H,6-29,34-43H2,1-5H3 |
| InChIKey | FDHPRHUJOBJPIL-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.28 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|