C50H99NO10 — CID 163381173
1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-(3-oxopropyl)amino]octanoate;methanol (PubChem CID 163381173) has the molecular formula C50H99NO10 and a molecular weight of 874.34 g/mol. Its IUPAC name is 1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-(3-oxopropyl)amino]octanoate;methanol.
| Compound Name | 1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-(3-oxopropyl)amino]octanoate;methanol |
|---|---|
| PubChem CID | 163381173 |
| Molecular Formula | C50H99NO10 |
| Molecular Weight | 874.34 g/mol |
| Exact Mass | 873.73 |
| IUPAC Name | 1,3-dihexoxypropan-2-yl 8-[[8-(1,3-dihexoxypropan-2-yloxy)-8-oxooctyl]-(3-oxopropyl)amino]octanoate;methanol |
| SMILES | CCCCCCOCC(COCCCCCC)OC(=O)CCCCCCCN(CCC=O)CCCCCCCC(=O)OC(COCCCCCC)COCCCCCC.CO |
| InChI | InChI=1S/C49H95NO9.CH4O/c1-5-9-13-27-38-54-42-46(43-55-39-28-14-10-6-2)58-48(52)32-23-19-17-21-25-34-50(36-31-37-51)35-26-22-18-20-24-33-49(53)59-47(44-56-40-29-15-11-7-3)45-57-41-30-16-12-8-4;1-2/h37,46-47H,5-36,38-45H2,1-4H3;2H,1H3 |
| InChIKey | JRPCDWOINJVHOR-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.34 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|