C16H15ClO2 — CID 82023364
2-(3-chlorophenyl)-2-(2,5-dimethylphenyl)acetic acid (PubChem CID 82023364) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-(2,5-dimethylphenyl)acetic acid.
| Compound Name | 2-(3-chlorophenyl)-2-(2,5-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 82023364 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(3-chlorophenyl)-2-(2,5-dimethylphenyl)acetic acid |
| SMILES | Cc1ccc(C)c(C(C(=O)O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H15ClO2/c1-10-6-7-11(2)14(8-10)15(16(18)19)12-4-3-5-13(17)9-12/h3-9,15H,1-2H3,(H,18,19) |
| InChIKey | WRTXAZIEPOIIRD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |