C19H25N — CID 66437881
1-(2,5-dimethylphenyl)-N-ethyl-1-phenylpropan-2-amine (PubChem CID 66437881) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-ethyl-1-phenylpropan-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-ethyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 66437881 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-ethyl-1-phenylpropan-2-amine |
| SMILES | CCNC(C)C(c1ccccc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H25N/c1-5-20-16(4)19(17-9-7-6-8-10-17)18-13-14(2)11-12-15(18)3/h6-13,16,19-20H,5H2,1-4H3 |
| InChIKey | BDXMVUHTYQSDKN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |