C9H12BrN — CID 116947555
bromo-(2,5-dimethylphenyl)methanamine (PubChem CID 116947555) has the molecular formula C9H12BrN and a molecular weight of 214.11 g/mol. Its IUPAC name is bromo-(2,5-dimethylphenyl)methanamine.
| Compound Name | bromo-(2,5-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 116947555 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | bromo-(2,5-dimethylphenyl)methanamine |
| SMILES | Cc1ccc(C)c(C(N)Br)c1 |
| InChI | InChI=1S/C9H12BrN/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5,9H,11H2,1-2H3 |
| InChIKey | IWRNNIUAKJGGHE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|