C10H13NO — CID 116938991
2-amino-2-(2,5-dimethylphenyl)acetaldehyde (PubChem CID 116938991) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-amino-2-(2,5-dimethylphenyl)acetaldehyde.
| Compound Name | 2-amino-2-(2,5-dimethylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 116938991 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-amino-2-(2,5-dimethylphenyl)acetaldehyde |
| SMILES | Cc1ccc(C)c(C(N)C=O)c1 |
| InChI | InChI=1S/C10H13NO/c1-7-3-4-8(2)9(5-7)10(11)6-12/h3-6,10H,11H2,1-2H3 |
| InChIKey | OIZKUPYTUJBICR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|