C12H15FO2 — CID 79366785
ethyl 2-(2,5-dimethylphenyl)-2-fluoroacetate (PubChem CID 79366785) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethylphenyl)-2-fluoroacetate.
| Compound Name | ethyl 2-(2,5-dimethylphenyl)-2-fluoroacetate |
|---|---|
| PubChem CID | 79366785 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | ethyl 2-(2,5-dimethylphenyl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)c1cc(C)ccc1C |
| InChI | InChI=1S/C12H15FO2/c1-4-15-12(14)11(13)10-7-8(2)5-6-9(10)3/h5-7,11H,4H2,1-3H3 |
| InChIKey | TVIPUAGUBRCIMT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |