C13H19Br — CID 63442067
2-(1-bromo-2,2-dimethylpropyl)-1,4-dimethylbenzene (PubChem CID 63442067) has the molecular formula C13H19Br and a molecular weight of 255.20 g/mol. Its IUPAC name is 2-(1-bromo-2,2-dimethylpropyl)-1,4-dimethylbenzene.
| Compound Name | 2-(1-bromo-2,2-dimethylpropyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 63442067 |
| Molecular Formula | C13H19Br |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(1-bromo-2,2-dimethylpropyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C(Br)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H19Br/c1-9-6-7-10(2)11(8-9)12(14)13(3,4)5/h6-8,12H,1-5H3 |
| InChIKey | DXZYPNMGNLSCIV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|