C14H21Br — CID 63442120
2-(1-bromo-2,2-dimethylbutyl)-1,4-dimethylbenzene (PubChem CID 63442120) has the molecular formula C14H21Br and a molecular weight of 269.23 g/mol. Its IUPAC name is 2-(1-bromo-2,2-dimethylbutyl)-1,4-dimethylbenzene.
| Compound Name | 2-(1-bromo-2,2-dimethylbutyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 63442120 |
| Molecular Formula | C14H21Br |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-(1-bromo-2,2-dimethylbutyl)-1,4-dimethylbenzene |
| SMILES | CCC(C)(C)C(Br)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H21Br/c1-6-14(4,5)13(15)12-9-10(2)7-8-11(12)3/h7-9,13H,6H2,1-5H3 |
| InChIKey | QPSVMFXTXXFZSE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|