C15H26N2 — CID 116949958
1-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine (PubChem CID 116949958) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine.
| Compound Name | 1-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949958 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine |
| SMILES | CNC(c1cc(C)ccc1C)C(C)(C)CCN |
| InChI | InChI=1S/C15H26N2/c1-11-6-7-12(2)13(10-11)14(17-5)15(3,4)8-9-16/h6-7,10,14,17H,8-9,16H2,1-5H3 |
| InChIKey | IJRPLLGTAWUNEP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |