C14H23N — CID 43483759
1-(2,5-dimethylphenyl)-N,2,2-trimethylpropan-1-amine (PubChem CID 43483759) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N,2,2-trimethylpropan-1-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N,2,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 43483759 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N,2,2-trimethylpropan-1-amine |
| SMILES | CNC(c1cc(C)ccc1C)C(C)(C)C |
| InChI | InChI=1S/C14H23N/c1-10-7-8-11(2)12(9-10)13(15-6)14(3,4)5/h7-9,13,15H,1-6H3 |
| InChIKey | BHRJENFKJAZOAQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |